C13H19N9O4S — CID 170929155
(3S,7R,7aR)-3-[bis(2-azidoethyl)carbamoyl]-2,2-dimethyl-5-oxo-3,6,7,7a-tetrahydroimidazo[5,1-b][1,3]thiazole-7-carboxylic acid (PubChem CID 170929155) has the molecular formula C13H19N9O4S and a molecular weight of 397.42 g/mol. Its IUPAC name is (3S,7R,7aR)-3-[bis(2-azidoethyl)carbamoyl]-2,2-dimethyl-5-oxo-3,6,7,7a-tetrahydroimidazo[5,1-b][1,3]thiazole-7-carboxylic acid.
| Compound Name | (3S,7R,7aR)-3-[bis(2-azidoethyl)carbamoyl]-2,2-dimethyl-5-oxo-3,6,7,7a-tetrahydroimidazo[5,1-b][1,3]thiazole-7-carboxylic acid |
|---|---|
| PubChem CID | 170929155 |
| Molecular Formula | C13H19N9O4S |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | (3S,7R,7aR)-3-[bis(2-azidoethyl)carbamoyl]-2,2-dimethyl-5-oxo-3,6,7,7a-tetrahydroimidazo[5,1-b][1,3]thiazole-7-carboxylic acid |
| SMILES | CC1(C)S[C@@H]2[C@@H](C(=O)O)NC(=O)N2[C@H]1C(=O)N(CCN=[N+]=[N-])CCN=[N+]=[N-] |
| InChI | InChI=1S/C13H19N9O4S/c1-13(2)8(22-10(27-13)7(11(24)25)18-12(22)26)9(23)21(5-3-16-19-14)6-4-17-20-15/h7-8,10H,3-6H2,1-2H3,(H,18,26)(H,24,25)/t7-,8-,10+/m0/s1 |
| InChIKey | LEKWZECGODUJPT-OYNCUSHFSA-N |
| XLogP | 1.13 |
| TPSA | 187.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|