C31H44BN3O5 — CID 170929443
4,4-dimethyl-10-[3-[2-(oxan-2-yloxy)propan-2-yl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),7-dien-9-one (PubChem CID 170929443) has the molecular formula C31H44BN3O5 and a molecular weight of 549.52 g/mol. Its IUPAC name is 4,4-dimethyl-10-[3-[2-(oxan-2-yloxy)propan-2-yl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),7-dien-9-one.
| Compound Name | 4,4-dimethyl-10-[3-[2-(oxan-2-yloxy)propan-2-yl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),7-dien-9-one |
|---|---|
| PubChem CID | 170929443 |
| Molecular Formula | C31H44BN3O5 |
| Molecular Weight | 549.52 g/mol |
| Exact Mass | 549.34 |
| IUPAC Name | 4,4-dimethyl-10-[3-[2-(oxan-2-yloxy)propan-2-yl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),7-dien-9-one |
| SMILES | CC1(C)Cc2cc3n(c2C1)CCN(c1nccc(B2OC(C)(C)C(C)(C)O2)c1C(C)(C)OC1CCCCO1)C3=O |
| InChI | InChI=1S/C31H44BN3O5/c1-28(2)18-20-17-22-27(36)35(15-14-34(22)23(20)19-28)26-25(29(3,4)38-24-11-9-10-16-37-24)21(12-13-33-26)32-39-30(5,6)31(7,8)40-32/h12-13,17,24H,9-11,14-16,18-19H2,1-8H3 |
| InChIKey | ANZWCJBPDWMILL-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 75.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.52 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|