C42H43BO2Si4 — CID 170930231
6,16-bis(1,8-dimethyl-1,8-disilatricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-4-yl)-8,14-dioxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene (PubChem CID 170930231) has the molecular formula C42H43BO2Si4 and a molecular weight of 702.96 g/mol. Its IUPAC name is 6,16-bis(1,8-dimethyl-1,8-disilatricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-4-yl)-8,14-dioxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene.
| Compound Name | 6,16-bis(1,8-dimethyl-1,8-disilatricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-4-yl)-8,14-dioxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene |
|---|---|
| PubChem CID | 170930231 |
| Molecular Formula | C42H43BO2Si4 |
| Molecular Weight | 702.96 g/mol |
| Exact Mass | 702.24 |
| IUPAC Name | 6,16-bis(1,8-dimethyl-1,8-disilatricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-4-yl)-8,14-dioxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene |
| SMILES | C[Si]12CC[Si](C)(CC1)c1cc(-c3cccc4c3Oc3cccc5c3B4c3cccc(-c4ccc6c(c4)[Si]4(C)CC[Si]6(C)CC4)c3O5)ccc12 |
| InChI | InChI=1S/C42H43BO2Si4/c1-46-18-22-48(3,23-19-46)38-26-28(14-16-36(38)46)30-8-5-10-32-41(30)44-34-12-7-13-35-40(34)43(32)33-11-6-9-31(42(33)45-35)29-15-17-37-39(27-29)49(4)24-20-47(37,2)21-25-49/h5-17,26-27H,18-25H2,1-4H3 |
| InChIKey | DMQURSSQUXRJKE-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.96 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|