C16H24NO+ — CID 170933131
(4R,5S)-4-methyl-5-phenyl-2,3-di(propan-2-yl)-4,5-dihydro-1,3-oxazol-3-ium (PubChem CID 170933131) has the molecular formula C16H24NO+ and a molecular weight of 246.37 g/mol. Its IUPAC name is (4R,5S)-4-methyl-5-phenyl-2,3-di(propan-2-yl)-4,5-dihydro-1,3-oxazol-3-ium.
| Compound Name | (4R,5S)-4-methyl-5-phenyl-2,3-di(propan-2-yl)-4,5-dihydro-1,3-oxazol-3-ium |
|---|---|
| PubChem CID | 170933131 |
| Molecular Formula | C16H24NO+ |
| Molecular Weight | 246.37 g/mol |
| Exact Mass | 246.19 |
| IUPAC Name | (4R,5S)-4-methyl-5-phenyl-2,3-di(propan-2-yl)-4,5-dihydro-1,3-oxazol-3-ium |
| SMILES | CC(C)C1=[N+](C(C)C)[C@H](C)[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C16H24NO/c1-11(2)16-17(12(3)4)13(5)15(18-16)14-9-7-6-8-10-14/h6-13,15H,1-5H3/q+1/t13-,15-/m1/s1 |
| InChIKey | QWFFWEFAFCOFDF-UKRRQHHQSA-N |
| XLogP | 3.62 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.37 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|