C44H45N3O — CID 170933913
(3aS,9bR)-2-[5-[2-(4-tert-butyl-2-pyridinyl)carbazol-9-yl]-2,4-dimethylphenyl]-5,5,7,9b-tetramethyl-3a,4-dihydrobenzo[e][1,3]benzoxazole (PubChem CID 170933913) has the molecular formula C44H45N3O and a molecular weight of 631.86 g/mol. Its IUPAC name is (3aS,9bR)-2-[5-[2-(4-tert-butyl-2-pyridinyl)carbazol-9-yl]-2,4-dimethylphenyl]-5,5,7,9b-tetramethyl-3a,4-dihydrobenzo[e][1,3]benzoxazole.
| Compound Name | (3aS,9bR)-2-[5-[2-(4-tert-butyl-2-pyridinyl)carbazol-9-yl]-2,4-dimethylphenyl]-5,5,7,9b-tetramethyl-3a,4-dihydrobenzo[e][1,3]benzoxazole |
|---|---|
| PubChem CID | 170933913 |
| Molecular Formula | C44H45N3O |
| Molecular Weight | 631.86 g/mol |
| Exact Mass | 631.36 |
| IUPAC Name | (3aS,9bR)-2-[5-[2-(4-tert-butyl-2-pyridinyl)carbazol-9-yl]-2,4-dimethylphenyl]-5,5,7,9b-tetramethyl-3a,4-dihydrobenzo[e][1,3]benzoxazole |
| SMILES | Cc1ccc2c(c1)C(C)(C)C[C@@H]1OC(c3cc(-n4c5ccccc5c5ccc(-c6cc(C(C)(C)C)ccn6)cc54)c(C)cc3C)=N[C@]21C |
| InChI | InChI=1S/C44H45N3O/c1-26-14-17-34-35(20-26)43(7,8)25-40-44(34,9)46-41(48-40)33-24-38(28(3)21-27(33)2)47-37-13-11-10-12-31(37)32-16-15-29(22-39(32)47)36-23-30(18-19-45-36)42(4,5)6/h10-24,40H,25H2,1-9H3/t40-,44+/m0/s1 |
| InChIKey | HXIZKSJVZJATMC-UTXDEELTSA-N |
| XLogP | 10.81 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.86 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |