C44H37N3OPt — CID 170935886
(4R,5R)-2-[5-[2-(4-tert-butyl-2-pyridinyl)-1H-carbazol-1-id-9-yl]-2,4-dimethylbenzene-6-id-1-yl]-4,5-diphenyl-4,5-dihydro-1,3-oxazole;platinum(2+) (PubChem CID 170935886) has the molecular formula C44H37N3OPt and a molecular weight of 818.88 g/mol. Its IUPAC name is (4R,5R)-2-[5-[2-(4-tert-butyl-2-pyridinyl)-1H-carbazol-1-id-9-yl]-2,4-dimethylbenzene-6-id-1-yl]-4,5-diphenyl-4,5-dihydro-1,3-oxazole;platinum(2+).
| Compound Name | (4R,5R)-2-[5-[2-(4-tert-butyl-2-pyridinyl)-1H-carbazol-1-id-9-yl]-2,4-dimethylbenzene-6-id-1-yl]-4,5-diphenyl-4,5-dihydro-1,3-oxazole;platinum(2+) |
|---|---|
| PubChem CID | 170935886 |
| Molecular Formula | C44H37N3OPt |
| Molecular Weight | 818.88 g/mol |
| Exact Mass | 818.26 |
| IUPAC Name | (4R,5R)-2-[5-[2-(4-tert-butyl-2-pyridinyl)-1H-carbazol-1-id-9-yl]-2,4-dimethylbenzene-6-id-1-yl]-4,5-diphenyl-4,5-dihydro-1,3-oxazole;platinum(2+) |
| SMILES | Cc1cc(C)c(-n2c3[c-]c(-c4cc(C(C)(C)C)ccn4)ccc3c3ccccc32)[c-]c1C1=N[C@H](c2ccccc2)[C@@H](c2ccccc2)O1.[Pt+2] |
| InChI | InChI=1S/C44H37N3O.Pt/c1-28-24-29(2)39(27-36(28)43-46-41(30-14-8-6-9-15-30)42(48-43)31-16-10-7-11-17-31)47-38-19-13-12-18-34(38)35-21-20-32(25-40(35)47)37-26-33(22-23-45-37)44(3,4)5;/h6-24,26,41-42H,1-5H3;/q-2;+2/t41-,42-;/m1./s1 |
| InChIKey | ACMHAHJQKMWYQU-FSYWDRBWSA-N |
| XLogP | 10.62 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.88 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|