C20H19N3O5S — CID 170935976
4-[5-(2,2-diethyl-4-oxo-3H-chromen-6-yl)-1,2,4-oxadiazol-3-yl]pyridine-2-sulfinic acid (PubChem CID 170935976) has the molecular formula C20H19N3O5S and a molecular weight of 413.46 g/mol. Its IUPAC name is 4-[5-(2,2-diethyl-4-oxo-3H-chromen-6-yl)-1,2,4-oxadiazol-3-yl]pyridine-2-sulfinic acid.
| Compound Name | 4-[5-(2,2-diethyl-4-oxo-3H-chromen-6-yl)-1,2,4-oxadiazol-3-yl]pyridine-2-sulfinic acid |
|---|---|
| PubChem CID | 170935976 |
| Molecular Formula | C20H19N3O5S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 4-[5-(2,2-diethyl-4-oxo-3H-chromen-6-yl)-1,2,4-oxadiazol-3-yl]pyridine-2-sulfinic acid |
| SMILES | CCC1(CC)CC(=O)c2cc(-c3nc(-c4ccnc(S(=O)O)c4)no3)ccc2O1 |
| InChI | InChI=1S/C20H19N3O5S/c1-3-20(4-2)11-15(24)14-9-13(5-6-16(14)27-20)19-22-18(23-28-19)12-7-8-21-17(10-12)29(25)26/h5-10H,3-4,11H2,1-2H3,(H,25,26) |
| InChIKey | IRUQXGKCNAMDJU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 115.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|