C23H28N2O2S — CID 17093667
3-cyclohexyl-N-[(2-phenylmethoxyphenyl)carbamothioyl]propanamide (PubChem CID 17093667) has the molecular formula C23H28N2O2S and a molecular weight of 396.56 g/mol. Its IUPAC name is 3-cyclohexyl-N-[(2-phenylmethoxyphenyl)carbamothioyl]propanamide.
| Compound Name | 3-cyclohexyl-N-[(2-phenylmethoxyphenyl)carbamothioyl]propanamide |
|---|---|
| PubChem CID | 17093667 |
| Molecular Formula | C23H28N2O2S |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 3-cyclohexyl-N-[(2-phenylmethoxyphenyl)carbamothioyl]propanamide |
| SMILES | O=C(CCC1CCCCC1)NC(=S)Nc1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C23H28N2O2S/c26-22(16-15-18-9-3-1-4-10-18)25-23(28)24-20-13-7-8-14-21(20)27-17-19-11-5-2-6-12-19/h2,5-8,11-14,18H,1,3-4,9-10,15-17H2,(H2,24,25,26,28) |
| InChIKey | ABCVPDVRDQHHOM-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|