About 3-(3-methyl-1-methylsulfonylbutan-2-yl)-azanidacyclobutane;uranium
3-(3-methyl-1-methylsulfonylbutan-2-yl)-azanidacyclobutane;uranium (PubChem CID 170937685) has the molecular formula C9H18NO2SU-
and a molecular weight of 442.34 g/mol. Its IUPAC name is 3-(3-methyl-1-methylsulfonylbutan-2-yl)-azanidacyclobutane;uranium.
Molecular Properties
| Compound Name | 3-(3-methyl-1-methylsulfonylbutan-2-yl)-azanidacyclobutane;uranium |
| PubChem CID | 170937685 |
| Molecular Formula | C9H18NO2SU- |
| Molecular Weight | 442.34 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 3-(3-methyl-1-methylsulfonylbutan-2-yl)-azanidacyclobutane;uranium |
| SMILES | CC(C)C(CS(C)(=O)=O)C1C[N-]C1.[U] |
| InChI | InChI=1S/C9H18NO2S.U/c1-7(2)9(6-13(3,11)12)8-4-10-5-8;/h7-9H,4-6H2,1-3H3;/q-1; |
| InChIKey | ZSDUKOIZBGXZAB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 48.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.34 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(3-methyl-1-methylsulfonylbutan-2-yl)-azanidacyclobutane;uranium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-methyl-1-methylsulfonylbutan-2-yl)-azanidacyclobutane;uranium?
The IUPAC name of 3-(3-methyl-1-methylsulfonylbutan-2-yl)-azanidacyclobutane;uranium (CID 170937685) is 3-(3-methyl-1-methylsulfonylbutan-2-yl)-azanidacyclobutane;uranium.
What is the SMILES notation for 3-(3-methyl-1-methylsulfonylbutan-2-yl)-azanidacyclobutane;uranium?
The canonical SMILES for 3-(3-methyl-1-methylsulfonylbutan-2-yl)-azanidacyclobutane;uranium is CC(C)C(CS(C)(=O)=O)C1C[N-]C1.[U].
What is the InChIKey of 3-(3-methyl-1-methylsulfonylbutan-2-yl)-azanidacyclobutane;uranium?
The InChIKey is ZSDUKOIZBGXZAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18NO2S.U/c1-7(2)9(6-13(3,11)12)8-4-10-5-8;/h7-9H,4-6H2,1-3H3;/q-1;.
What are the key properties of 3-(3-methyl-1-methylsulfonylbutan-2-yl)-azanidacyclobutane;uranium?
3-(3-methyl-1-methylsulfonylbutan-2-yl)-azanidacyclobutane;uranium has a molecular weight of 442.34 g/mol, XLogP of 1.31, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methyl-1-methylsulfonylbutan-2-yl)-azanidacyclobutane;uranium is sourced from PubChem (CID 170937685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).