C42H9F — CID 170937962
(17Z)-1-fluoro-18-undeca-1,3,5,7,9-pentaynylhentriaconta-1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,17-hexadecaen-19,21,23,25,27,29-hexayne (PubChem CID 170937962) has the molecular formula C42H9F and a molecular weight of 532.53 g/mol. Its IUPAC name is (17Z)-1-fluoro-18-undeca-1,3,5,7,9-pentaynylhentriaconta-1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,17-hexadecaen-19,21,23,25,27,29-hexayne.
| Compound Name | (17Z)-1-fluoro-18-undeca-1,3,5,7,9-pentaynylhentriaconta-1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,17-hexadecaen-19,21,23,25,27,29-hexayne |
|---|---|
| PubChem CID | 170937962 |
| Molecular Formula | C42H9F |
| Molecular Weight | 532.53 g/mol |
| Exact Mass | 532.07 |
| IUPAC Name | (17Z)-1-fluoro-18-undeca-1,3,5,7,9-pentaynylhentriaconta-1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,17-hexadecaen-19,21,23,25,27,29-hexayne |
| SMILES | CC#CC#CC#CC#CC#CC#C/C(C#CC#CC#CC#CC#CC)=C\C=C=C=C=C=C=C=C=C=C=C=C=C=C=C=CF |
| InChI | InChI=1S/C42H9F/c1-3-5-7-9-11-13-19-23-27-31-35-39-42(38-34-30-26-22-12-10-8-6-4-2)40-36-32-28-24-20-17-15-14-16-18-21-25-29-33-37-41-43/h36,40-41H,1-2H3/b42-40- |
| InChIKey | BKXSGAAXUCYPJB-GTXLIONYSA-N |
| XLogP | 4.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.53 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|