C24H26N6O3 — CID 170939375
[4-[[(1R)-1-(3-amino-5-isocyanophenyl)ethyl]amino]-6-methoxy-2-methylquinazolin-7-yl]-morpholin-4-ylmethanone (PubChem CID 170939375) has the molecular formula C24H26N6O3 and a molecular weight of 446.51 g/mol. Its IUPAC name is [4-[[(1R)-1-(3-amino-5-isocyanophenyl)ethyl]amino]-6-methoxy-2-methylquinazolin-7-yl]-morpholin-4-ylmethanone.
| Compound Name | [4-[[(1R)-1-(3-amino-5-isocyanophenyl)ethyl]amino]-6-methoxy-2-methylquinazolin-7-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 170939375 |
| Molecular Formula | C24H26N6O3 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | [4-[[(1R)-1-(3-amino-5-isocyanophenyl)ethyl]amino]-6-methoxy-2-methylquinazolin-7-yl]-morpholin-4-ylmethanone |
| SMILES | [C-]#[N+]c1cc(N)cc([C@@H](C)Nc2nc(C)nc3cc(C(=O)N4CCOCC4)c(OC)cc23)c1 |
| InChI | InChI=1S/C24H26N6O3/c1-14(16-9-17(25)11-18(10-16)26-3)27-23-19-13-22(32-4)20(12-21(19)28-15(2)29-23)24(31)30-5-7-33-8-6-30/h9-14H,5-8,25H2,1-2,4H3,(H,27,28,29)/t14-/m1/s1 |
| InChIKey | FIJVQMOOECBPFK-CQSZACIVSA-N |
| XLogP | 3.73 |
| TPSA | 106.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|