About 2,8-ditert-butyl-6-oxa-2,8-diazaspiro[3.5]nonane
2,8-ditert-butyl-6-oxa-2,8-diazaspiro[3.5]nonane (PubChem CID 170939545) has the molecular formula C14H28N2O
and a molecular weight of 240.39 g/mol. Its IUPAC name is 2,8-ditert-butyl-6-oxa-2,8-diazaspiro[3.5]nonane.
Molecular Properties
| Compound Name | 2,8-ditert-butyl-6-oxa-2,8-diazaspiro[3.5]nonane |
| PubChem CID | 170939545 |
| Molecular Formula | C14H28N2O |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.22 |
| IUPAC Name | 2,8-ditert-butyl-6-oxa-2,8-diazaspiro[3.5]nonane |
| SMILES | CC(C)(C)N1COCC2(C1)CN(C(C)(C)C)C2 |
| InChI | InChI=1S/C14H28N2O/c1-12(2,3)15-7-14(8-15)9-16(11-17-10-14)13(4,5)6/h7-11H2,1-6H3 |
| InChIKey | YRZOBEXHXOSFBM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,8-ditert-butyl-6-oxa-2,8-diazaspiro[3.5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,8-ditert-butyl-6-oxa-2,8-diazaspiro[3.5]nonane?
The IUPAC name of 2,8-ditert-butyl-6-oxa-2,8-diazaspiro[3.5]nonane (CID 170939545) is 2,8-ditert-butyl-6-oxa-2,8-diazaspiro[3.5]nonane.
What is the SMILES notation for 2,8-ditert-butyl-6-oxa-2,8-diazaspiro[3.5]nonane?
The canonical SMILES for 2,8-ditert-butyl-6-oxa-2,8-diazaspiro[3.5]nonane is CC(C)(C)N1COCC2(C1)CN(C(C)(C)C)C2.
What is the InChIKey of 2,8-ditert-butyl-6-oxa-2,8-diazaspiro[3.5]nonane?
The InChIKey is YRZOBEXHXOSFBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2O/c1-12(2,3)15-7-14(8-15)9-16(11-17-10-14)13(4,5)6/h7-11H2,1-6H3.
What are the key properties of 2,8-ditert-butyl-6-oxa-2,8-diazaspiro[3.5]nonane?
2,8-ditert-butyl-6-oxa-2,8-diazaspiro[3.5]nonane has a molecular weight of 240.39 g/mol, XLogP of 2.18, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,8-ditert-butyl-6-oxa-2,8-diazaspiro[3.5]nonane is sourced from PubChem (CID 170939545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).