C8H9FN2O2S — CID 170939598
ethyl (Z)-2-fluoro-3-(5-methyl-1,3,4-thiadiazol-2-yl)prop-2-enoate (PubChem CID 170939598) has the molecular formula C8H9FN2O2S and a molecular weight of 216.24 g/mol. Its IUPAC name is ethyl (Z)-2-fluoro-3-(5-methyl-1,3,4-thiadiazol-2-yl)prop-2-enoate.
| Compound Name | ethyl (Z)-2-fluoro-3-(5-methyl-1,3,4-thiadiazol-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 170939598 |
| Molecular Formula | C8H9FN2O2S |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | ethyl (Z)-2-fluoro-3-(5-methyl-1,3,4-thiadiazol-2-yl)prop-2-enoate |
| SMILES | CCOC(=O)/C(F)=C/c1nnc(C)s1 |
| InChI | InChI=1S/C8H9FN2O2S/c1-3-13-8(12)6(9)4-7-11-10-5(2)14-7/h4H,3H2,1-2H3/b6-4- |
| InChIKey | DGHXKYFGLMAMJF-XQRVVYSFSA-N |
| XLogP | 1.72 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|