About 5-[(1Z)-buta-1,3-dienyl]-1,3-dimethyl-2-(2-methyl-1-benzofuran-3-yl)pyrrole
5-[(1Z)-buta-1,3-dienyl]-1,3-dimethyl-2-(2-methyl-1-benzofuran-3-yl)pyrrole (PubChem CID 170941031) has the molecular formula C19H19NO
and a molecular weight of 277.37 g/mol. Its IUPAC name is 5-[(1Z)-buta-1,3-dienyl]-1,3-dimethyl-2-(2-methyl-1-benzofuran-3-yl)pyrrole.
Molecular Properties
| Compound Name | 5-[(1Z)-buta-1,3-dienyl]-1,3-dimethyl-2-(2-methyl-1-benzofuran-3-yl)pyrrole |
| PubChem CID | 170941031 |
| Molecular Formula | C19H19NO |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 5-[(1Z)-buta-1,3-dienyl]-1,3-dimethyl-2-(2-methyl-1-benzofuran-3-yl)pyrrole |
| SMILES | C=C/C=C\c1cc(C)c(-c2c(C)oc3ccccc23)n1C |
| InChI | InChI=1S/C19H19NO/c1-5-6-9-15-12-13(2)19(20(15)4)18-14(3)21-17-11-8-7-10-16(17)18/h5-12H,1H2,2-4H3/b9-6- |
| InChIKey | GJEXRBGKTBBLNE-TWGQIWQCSA-N |
| XLogP | 5.25 |
| TPSA | 18.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(1Z)-buta-1,3-dienyl]-1,3-dimethyl-2-(2-methyl-1-benzofuran-3-yl)pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1Z)-buta-1,3-dienyl]-1,3-dimethyl-2-(2-methyl-1-benzofuran-3-yl)pyrrole?
The IUPAC name of 5-[(1Z)-buta-1,3-dienyl]-1,3-dimethyl-2-(2-methyl-1-benzofuran-3-yl)pyrrole (CID 170941031) is 5-[(1Z)-buta-1,3-dienyl]-1,3-dimethyl-2-(2-methyl-1-benzofuran-3-yl)pyrrole.
What is the SMILES notation for 5-[(1Z)-buta-1,3-dienyl]-1,3-dimethyl-2-(2-methyl-1-benzofuran-3-yl)pyrrole?
The canonical SMILES for 5-[(1Z)-buta-1,3-dienyl]-1,3-dimethyl-2-(2-methyl-1-benzofuran-3-yl)pyrrole is C=C/C=C\c1cc(C)c(-c2c(C)oc3ccccc23)n1C.
What is the InChIKey of 5-[(1Z)-buta-1,3-dienyl]-1,3-dimethyl-2-(2-methyl-1-benzofuran-3-yl)pyrrole?
The InChIKey is GJEXRBGKTBBLNE-TWGQIWQCSA-N. The full InChI is InChI=1S/C19H19NO/c1-5-6-9-15-12-13(2)19(20(15)4)18-14(3)21-17-11-8-7-10-16(17)18/h5-12H,1H2,2-4H3/b9-6-.
What are the key properties of 5-[(1Z)-buta-1,3-dienyl]-1,3-dimethyl-2-(2-methyl-1-benzofuran-3-yl)pyrrole?
5-[(1Z)-buta-1,3-dienyl]-1,3-dimethyl-2-(2-methyl-1-benzofuran-3-yl)pyrrole has a molecular weight of 277.37 g/mol, XLogP of 5.25, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1Z)-buta-1,3-dienyl]-1,3-dimethyl-2-(2-methyl-1-benzofuran-3-yl)pyrrole is sourced from PubChem (CID 170941031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).