C25H25FN4O3 — CID 170941274
3-ethoxy-4-(3-fluorophenyl)-N-[(5-hydroxy-4-methylpyrazolo[4,3-c]pyridin-7-yl)methyl]-N,2-dimethylbenzamide (PubChem CID 170941274) has the molecular formula C25H25FN4O3 and a molecular weight of 448.50 g/mol. Its IUPAC name is 3-ethoxy-4-(3-fluorophenyl)-N-[(5-hydroxy-4-methylpyrazolo[4,3-c]pyridin-7-yl)methyl]-N,2-dimethylbenzamide.
| Compound Name | 3-ethoxy-4-(3-fluorophenyl)-N-[(5-hydroxy-4-methylpyrazolo[4,3-c]pyridin-7-yl)methyl]-N,2-dimethylbenzamide |
|---|---|
| PubChem CID | 170941274 |
| Molecular Formula | C25H25FN4O3 |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 3-ethoxy-4-(3-fluorophenyl)-N-[(5-hydroxy-4-methylpyrazolo[4,3-c]pyridin-7-yl)methyl]-N,2-dimethylbenzamide |
| SMILES | CCOc1c(-c2cccc(F)c2)ccc(C(=O)N(C)Cc2cn(O)c(C)c3cnnc2-3)c1C |
| InChI | InChI=1S/C25H25FN4O3/c1-5-33-24-15(2)20(9-10-21(24)17-7-6-8-19(26)11-17)25(31)29(4)13-18-14-30(32)16(3)22-12-27-28-23(18)22/h6-12,14,32H,5,13H2,1-4H3 |
| InChIKey | HGBKFOKQFBJZNF-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|