C19H16 — CID 170941931
1,2,3,4,5-pentadeuterio-6-(5-methyl-2-phenylphenyl)benzene (PubChem CID 170941931) has the molecular formula C19H16 and a molecular weight of 249.37 g/mol. Its IUPAC name is 1,2,3,4,5-pentadeuterio-6-(5-methyl-2-phenylphenyl)benzene.
| Compound Name | 1,2,3,4,5-pentadeuterio-6-(5-methyl-2-phenylphenyl)benzene |
|---|---|
| PubChem CID | 170941931 |
| Molecular Formula | C19H16 |
| Molecular Weight | 249.37 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | 1,2,3,4,5-pentadeuterio-6-(5-methyl-2-phenylphenyl)benzene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cc(C)ccc2-c2ccccc2)c([2H])c1[2H] |
| InChI | InChI=1S/C19H16/c1-15-12-13-18(16-8-4-2-5-9-16)19(14-15)17-10-6-3-7-11-17/h2-14H,1H3/i3D,6D,7D,10D,11D |
| InChIKey | AYVWUPXIMBDBSX-LKOJFEAXSA-N |
| XLogP | 5.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.37 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |