C31H18ClN3O — CID 170941961
2-(4-chloronaphthalen-1-yl)-4-dibenzofuran-4-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazine (PubChem CID 170941961) has the molecular formula C31H18ClN3O and a molecular weight of 488.99 g/mol. Its IUPAC name is 2-(4-chloronaphthalen-1-yl)-4-dibenzofuran-4-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazine.
| Compound Name | 2-(4-chloronaphthalen-1-yl)-4-dibenzofuran-4-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 170941961 |
| Molecular Formula | C31H18ClN3O |
| Molecular Weight | 488.99 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | 2-(4-chloronaphthalen-1-yl)-4-dibenzofuran-4-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3ccc(Cl)c4ccccc34)nc(-c3cccc4c3oc3ccccc34)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C31H18ClN3O/c32-26-18-17-24(20-11-4-5-12-21(20)26)30-33-29(19-9-2-1-3-10-19)34-31(35-30)25-15-8-14-23-22-13-6-7-16-27(22)36-28(23)25/h1-18H/i1D,2D,3D,9D,10D |
| InChIKey | GXBSMNJPMFJHNW-MYWHSQMISA-N |
| XLogP | 8.58 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.99 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |