About 3-hydroxybenzene-1,2,4-tricarbaldehyde
3-hydroxybenzene-1,2,4-tricarbaldehyde (PubChem CID 170942140) has the molecular formula C9H6O4
and a molecular weight of 178.14 g/mol. Its IUPAC name is 3-hydroxybenzene-1,2,4-tricarbaldehyde.
Molecular Properties
| Compound Name | 3-hydroxybenzene-1,2,4-tricarbaldehyde |
| PubChem CID | 170942140 |
| Molecular Formula | C9H6O4 |
| Molecular Weight | 178.14 g/mol |
| Exact Mass | 178.03 |
| IUPAC Name | 3-hydroxybenzene-1,2,4-tricarbaldehyde |
| SMILES | O=Cc1ccc(C=O)c(C=O)c1O |
| InChI | InChI=1S/C9H6O4/c10-3-6-1-2-7(4-11)9(13)8(6)5-12/h1-5,13H |
| InChIKey | JHKAYRKFKFISQY-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.14 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxybenzene-1,2,4-tricarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxybenzene-1,2,4-tricarbaldehyde?
The IUPAC name of 3-hydroxybenzene-1,2,4-tricarbaldehyde (CID 170942140) is 3-hydroxybenzene-1,2,4-tricarbaldehyde.
What is the SMILES notation for 3-hydroxybenzene-1,2,4-tricarbaldehyde?
The canonical SMILES for 3-hydroxybenzene-1,2,4-tricarbaldehyde is O=Cc1ccc(C=O)c(C=O)c1O.
What is the InChIKey of 3-hydroxybenzene-1,2,4-tricarbaldehyde?
The InChIKey is JHKAYRKFKFISQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6O4/c10-3-6-1-2-7(4-11)9(13)8(6)5-12/h1-5,13H.
What are the key properties of 3-hydroxybenzene-1,2,4-tricarbaldehyde?
3-hydroxybenzene-1,2,4-tricarbaldehyde has a molecular weight of 178.14 g/mol, XLogP of 0.83, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxybenzene-1,2,4-tricarbaldehyde is sourced from PubChem (CID 170942140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).