C37H40ClN3O3 — CID 170942369
N-[4-[7-chloro-5-(5-phenoxypentylamino)-2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl]-3-methylphenyl]-2-methylbenzamide (PubChem CID 170942369) has the molecular formula C37H40ClN3O3 and a molecular weight of 610.20 g/mol. Its IUPAC name is N-[4-[7-chloro-5-(5-phenoxypentylamino)-2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl]-3-methylphenyl]-2-methylbenzamide.
| Compound Name | N-[4-[7-chloro-5-(5-phenoxypentylamino)-2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl]-3-methylphenyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 170942369 |
| Molecular Formula | C37H40ClN3O3 |
| Molecular Weight | 610.20 g/mol |
| Exact Mass | 609.28 |
| IUPAC Name | N-[4-[7-chloro-5-(5-phenoxypentylamino)-2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl]-3-methylphenyl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)Nc1ccc(C(=O)N2CCCC(NCCCCCOc3ccccc3)c3cc(Cl)ccc32)c(C)c1 |
| InChI | InChI=1S/C37H40ClN3O3/c1-26-12-7-8-15-31(26)36(42)40-29-18-19-32(27(2)24-29)37(43)41-22-11-16-34(33-25-28(38)17-20-35(33)41)39-21-9-4-10-23-44-30-13-5-3-6-14-30/h3,5-8,12-15,17-20,24-25,34,39H,4,9-11,16,21-23H2,1-2H3,(H,40,42) |
| InChIKey | WZBAKFYNWLTWEI-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.20 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|