C64H44N4OPt-2 — CID 170942391
CID 170942391 (PubChem CID 170942391) has the molecular formula C64H44N4OPt-2 and a molecular weight of 1080.16 g/mol.
| Compound Name | CID 170942391 |
|---|---|
| PubChem CID | 170942391 |
| Molecular Formula | C64H44N4OPt-2 |
| Molecular Weight | 1080.16 g/mol |
| Exact Mass | 1079.32 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(-n2c3[c-]c4ccc3c3cc(ccc32)-c2ccccc2-c2ccccc2-c2ccccc2-c2cccc(c2)-c2ccccc2-[n+]2[c-]n(c3ccccc32)-c2[c-]c(ccc2)O4)c1.[Pt] |
| InChI | InChI=1S/C64H44N4O.Pt/c1-64(2,3)45-34-35-65-63(38-45)68-59-33-30-44-37-57(59)56-32-31-48(40-62(56)68)69-47-19-15-18-46(39-47)66-41-67(61-29-13-12-28-60(61)66)58-27-11-10-22-51(58)43-17-14-16-42(36-43)49-20-4-6-23-52(49)54-25-8-9-26-55(54)53-24-7-5-21-50(44)53;/h4-38H,1-3H3;/q-2; |
| InChIKey | KHAFIJRHGWFVKN-UHFFFAOYSA-N |
| XLogP | 15.54 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1080.16 |
| LogP ≤ 5 | 15.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|