About trans-(3S,4R)-4-fluoro-3-methyl-3-(nitromethyl)cyclohexan-1-one
trans-(3S,4R)-4-fluoro-3-methyl-3-(nitromethyl)cyclohexan-1-one (PubChem CID 170942521) has the molecular formula C8H12FNO3
and a molecular weight of 189.19 g/mol. Its IUPAC name is trans-(3S,4R)-4-fluoro-3-methyl-3-(nitromethyl)cyclohexan-1-one.
Molecular Properties
| Compound Name | trans-(3S,4R)-4-fluoro-3-methyl-3-(nitromethyl)cyclohexan-1-one |
| PubChem CID | 170942521 |
| Molecular Formula | C8H12FNO3 |
| Molecular Weight | 189.19 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | trans-(3S,4R)-4-fluoro-3-methyl-3-(nitromethyl)cyclohexan-1-one |
| SMILES | C[C@@]1(C[N+](=O)[O-])CC(=O)CC[C@H]1F |
| InChI | InChI=1S/C8H12FNO3/c1-8(5-10(12)13)4-6(11)2-3-7(8)9/h7H,2-5H2,1H3/t7-,8+/m1/s1 |
| InChIKey | FIJAXJSANQHYBL-SFYZADRCSA-N |
| XLogP | 1.36 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.19 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze trans-(3S,4R)-4-fluoro-3-methyl-3-(nitromethyl)cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(3S,4R)-4-fluoro-3-methyl-3-(nitromethyl)cyclohexan-1-one?
The IUPAC name of trans-(3S,4R)-4-fluoro-3-methyl-3-(nitromethyl)cyclohexan-1-one (CID 170942521) is trans-(3S,4R)-4-fluoro-3-methyl-3-(nitromethyl)cyclohexan-1-one.
What is the SMILES notation for trans-(3S,4R)-4-fluoro-3-methyl-3-(nitromethyl)cyclohexan-1-one?
The canonical SMILES for trans-(3S,4R)-4-fluoro-3-methyl-3-(nitromethyl)cyclohexan-1-one is C[C@@]1(C[N+](=O)[O-])CC(=O)CC[C@H]1F.
What is the InChIKey of trans-(3S,4R)-4-fluoro-3-methyl-3-(nitromethyl)cyclohexan-1-one?
The InChIKey is FIJAXJSANQHYBL-SFYZADRCSA-N. The full InChI is InChI=1S/C8H12FNO3/c1-8(5-10(12)13)4-6(11)2-3-7(8)9/h7H,2-5H2,1H3/t7-,8+/m1/s1.
What are the key properties of trans-(3S,4R)-4-fluoro-3-methyl-3-(nitromethyl)cyclohexan-1-one?
trans-(3S,4R)-4-fluoro-3-methyl-3-(nitromethyl)cyclohexan-1-one has a molecular weight of 189.19 g/mol, XLogP of 1.36, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(3S,4R)-4-fluoro-3-methyl-3-(nitromethyl)cyclohexan-1-one is sourced from PubChem (CID 170942521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).