C19H23N3O4 — CID 170942550
3-[(12-methyl-7,10-dioxadispiro[2.2.46.23]dodecan-12-yl)methylamino]-4-nitrobenzonitrile (PubChem CID 170942550) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is 3-[(12-methyl-7,10-dioxadispiro[2.2.46.23]dodecan-12-yl)methylamino]-4-nitrobenzonitrile.
| Compound Name | 3-[(12-methyl-7,10-dioxadispiro[2.2.46.23]dodecan-12-yl)methylamino]-4-nitrobenzonitrile |
|---|---|
| PubChem CID | 170942550 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 3-[(12-methyl-7,10-dioxadispiro[2.2.46.23]dodecan-12-yl)methylamino]-4-nitrobenzonitrile |
| SMILES | CC1(CNc2cc(C#N)ccc2[N+](=O)[O-])CC2(CCC13CC3)OCCO2 |
| InChI | InChI=1S/C19H23N3O4/c1-17(12-19(25-8-9-26-19)7-6-18(17)4-5-18)13-21-15-10-14(11-20)2-3-16(15)22(23)24/h2-3,10,21H,4-9,12-13H2,1H3 |
| InChIKey | WNUWLBNNTDOMSK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 97.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|