C26H36N4O6 — CID 170943268
[5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 2-[(2-phenyl-1-piperidin-2-ylethyl)amino]ethyl carbonate (PubChem CID 170943268) has the molecular formula C26H36N4O6 and a molecular weight of 500.60 g/mol. Its IUPAC name is [5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 2-[(2-phenyl-1-piperidin-2-ylethyl)amino]ethyl carbonate.
| Compound Name | [5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 2-[(2-phenyl-1-piperidin-2-ylethyl)amino]ethyl carbonate |
|---|---|
| PubChem CID | 170943268 |
| Molecular Formula | C26H36N4O6 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | [5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 2-[(2-phenyl-1-piperidin-2-ylethyl)amino]ethyl carbonate |
| SMILES | Cc1cn(C2CCC(COC(=O)OCCNC(Cc3ccccc3)C3CCCCN3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C26H36N4O6/c1-18-16-30(25(32)29-24(18)31)23-11-10-20(36-23)17-35-26(33)34-14-13-28-22(21-9-5-6-12-27-21)15-19-7-3-2-4-8-19/h2-4,7-8,16,20-23,27-28H,5-6,9-15,17H2,1H3,(H,29,31,32) |
| InChIKey | KHUWJXDQARICJR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 123.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|