C21H18BrNO3 — CID 17094328
5-bromo-2-methoxy-N-(2-phenylmethoxyphenyl)benzamide (PubChem CID 17094328) has the molecular formula C21H18BrNO3 and a molecular weight of 412.28 g/mol. Its IUPAC name is 5-bromo-2-methoxy-N-(2-phenylmethoxyphenyl)benzamide.
| Compound Name | 5-bromo-2-methoxy-N-(2-phenylmethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 17094328 |
| Molecular Formula | C21H18BrNO3 |
| Molecular Weight | 412.28 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | 5-bromo-2-methoxy-N-(2-phenylmethoxyphenyl)benzamide |
| SMILES | COc1ccc(Br)cc1C(=O)Nc1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C21H18BrNO3/c1-25-19-12-11-16(22)13-17(19)21(24)23-18-9-5-6-10-20(18)26-14-15-7-3-2-4-8-15/h2-13H,14H2,1H3,(H,23,24) |
| InChIKey | UXVZIEHXVOCPOA-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.28 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |