About (R)-4-(5-chloro-1,3-thiazol-2-yl)-2-methylpentane-2-sulfinamide
(R)-4-(5-chloro-1,3-thiazol-2-yl)-2-methylpentane-2-sulfinamide (PubChem CID 170943434) has the molecular formula C9H15ClN2OS2
and a molecular weight of 266.82 g/mol. Its IUPAC name is (R)-4-(5-chloro-1,3-thiazol-2-yl)-2-methylpentane-2-sulfinamide.
Molecular Properties
| Compound Name | (R)-4-(5-chloro-1,3-thiazol-2-yl)-2-methylpentane-2-sulfinamide |
| PubChem CID | 170943434 |
| Molecular Formula | C9H15ClN2OS2 |
| Molecular Weight | 266.82 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | (R)-4-(5-chloro-1,3-thiazol-2-yl)-2-methylpentane-2-sulfinamide |
| SMILES | CC(CC(C)(C)[S@](N)=O)c1ncc(Cl)s1 |
| InChI | InChI=1S/C9H15ClN2OS2/c1-6(4-9(2,3)15(11)13)8-12-5-7(10)14-8/h5-6H,4,11H2,1-3H3/t6?,15-/m1/s1 |
| InChIKey | ZWGBKYFFEZVRKK-CBRWWVBESA-N |
| XLogP | 2.69 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.82 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (R)-4-(5-chloro-1,3-thiazol-2-yl)-2-methylpentane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (R)-4-(5-chloro-1,3-thiazol-2-yl)-2-methylpentane-2-sulfinamide?
The IUPAC name of (R)-4-(5-chloro-1,3-thiazol-2-yl)-2-methylpentane-2-sulfinamide (CID 170943434) is (R)-4-(5-chloro-1,3-thiazol-2-yl)-2-methylpentane-2-sulfinamide.
What is the SMILES notation for (R)-4-(5-chloro-1,3-thiazol-2-yl)-2-methylpentane-2-sulfinamide?
The canonical SMILES for (R)-4-(5-chloro-1,3-thiazol-2-yl)-2-methylpentane-2-sulfinamide is CC(CC(C)(C)[S@](N)=O)c1ncc(Cl)s1.
What is the InChIKey of (R)-4-(5-chloro-1,3-thiazol-2-yl)-2-methylpentane-2-sulfinamide?
The InChIKey is ZWGBKYFFEZVRKK-CBRWWVBESA-N. The full InChI is InChI=1S/C9H15ClN2OS2/c1-6(4-9(2,3)15(11)13)8-12-5-7(10)14-8/h5-6H,4,11H2,1-3H3/t6?,15-/m1/s1.
What are the key properties of (R)-4-(5-chloro-1,3-thiazol-2-yl)-2-methylpentane-2-sulfinamide?
(R)-4-(5-chloro-1,3-thiazol-2-yl)-2-methylpentane-2-sulfinamide has a molecular weight of 266.82 g/mol, XLogP of 2.69, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (R)-4-(5-chloro-1,3-thiazol-2-yl)-2-methylpentane-2-sulfinamide is sourced from PubChem (CID 170943434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).