About ethyl 3-(1,6-dimethylindol-3-yl)-3-(5-fluoro-1-methylindol-3-yl)butanoate
ethyl 3-(1,6-dimethylindol-3-yl)-3-(5-fluoro-1-methylindol-3-yl)butanoate (PubChem CID 170944053) has the molecular formula C25H27FN2O2
and a molecular weight of 406.50 g/mol. Its IUPAC name is ethyl 3-(1,6-dimethylindol-3-yl)-3-(5-fluoro-1-methylindol-3-yl)butanoate.
Molecular Properties
| Compound Name | ethyl 3-(1,6-dimethylindol-3-yl)-3-(5-fluoro-1-methylindol-3-yl)butanoate |
| PubChem CID | 170944053 |
| Molecular Formula | C25H27FN2O2 |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | ethyl 3-(1,6-dimethylindol-3-yl)-3-(5-fluoro-1-methylindol-3-yl)butanoate |
| SMILES | CCOC(=O)CC(C)(c1cn(C)c2ccc(F)cc12)c1cn(C)c2cc(C)ccc12 |
| InChI | InChI=1S/C25H27FN2O2/c1-6-30-24(29)13-25(3,20-14-28(5)23-11-16(2)7-9-18(20)23)21-15-27(4)22-10-8-17(26)12-19(21)22/h7-12,14-15H,6,13H2,1-5H3 |
| InChIKey | CMPFLFZGBCTLNL-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 36.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 3-(1,6-dimethylindol-3-yl)-3-(5-fluoro-1-methylindol-3-yl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(1,6-dimethylindol-3-yl)-3-(5-fluoro-1-methylindol-3-yl)butanoate?
The IUPAC name of ethyl 3-(1,6-dimethylindol-3-yl)-3-(5-fluoro-1-methylindol-3-yl)butanoate (CID 170944053) is ethyl 3-(1,6-dimethylindol-3-yl)-3-(5-fluoro-1-methylindol-3-yl)butanoate.
What is the SMILES notation for ethyl 3-(1,6-dimethylindol-3-yl)-3-(5-fluoro-1-methylindol-3-yl)butanoate?
The canonical SMILES for ethyl 3-(1,6-dimethylindol-3-yl)-3-(5-fluoro-1-methylindol-3-yl)butanoate is CCOC(=O)CC(C)(c1cn(C)c2ccc(F)cc12)c1cn(C)c2cc(C)ccc12.
What is the InChIKey of ethyl 3-(1,6-dimethylindol-3-yl)-3-(5-fluoro-1-methylindol-3-yl)butanoate?
The InChIKey is CMPFLFZGBCTLNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27FN2O2/c1-6-30-24(29)13-25(3,20-14-28(5)23-11-16(2)7-9-18(20)23)21-15-27(4)22-10-8-17(26)12-19(21)22/h7-12,14-15H,6,13H2,1-5H3.
What are the key properties of ethyl 3-(1,6-dimethylindol-3-yl)-3-(5-fluoro-1-methylindol-3-yl)butanoate?
ethyl 3-(1,6-dimethylindol-3-yl)-3-(5-fluoro-1-methylindol-3-yl)butanoate has a molecular weight of 406.50 g/mol, XLogP of 5.38, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(1,6-dimethylindol-3-yl)-3-(5-fluoro-1-methylindol-3-yl)butanoate is sourced from PubChem (CID 170944053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).