C22H20FNO2 — CID 170945281
3-(3-fluoro-4-methylanilino)-3-(4-phenylphenyl)propanoic acid (PubChem CID 170945281) has the molecular formula C22H20FNO2 and a molecular weight of 349.41 g/mol. Its IUPAC name is 3-(3-fluoro-4-methylanilino)-3-(4-phenylphenyl)propanoic acid.
| Compound Name | 3-(3-fluoro-4-methylanilino)-3-(4-phenylphenyl)propanoic acid |
|---|---|
| PubChem CID | 170945281 |
| Molecular Formula | C22H20FNO2 |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 3-(3-fluoro-4-methylanilino)-3-(4-phenylphenyl)propanoic acid |
| SMILES | Cc1ccc(NC(CC(=O)O)c2ccc(-c3ccccc3)cc2)cc1F |
| InChI | InChI=1S/C22H20FNO2/c1-15-7-12-19(13-20(15)23)24-21(14-22(25)26)18-10-8-17(9-11-18)16-5-3-2-4-6-16/h2-13,21,24H,14H2,1H3,(H,25,26) |
| InChIKey | LNFWZDHUSSOLGL-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |