About methyl 2-(1-fluoro-2,2-diphenylethyl)-5-methoxy-1-methyl-6-oxopyrimidine-4-carboxylate
methyl 2-(1-fluoro-2,2-diphenylethyl)-5-methoxy-1-methyl-6-oxopyrimidine-4-carboxylate (PubChem CID 170945471) has the molecular formula C22H21FN2O4
and a molecular weight of 396.42 g/mol. Its IUPAC name is methyl 2-(1-fluoro-2,2-diphenylethyl)-5-methoxy-1-methyl-6-oxopyrimidine-4-carboxylate.
Molecular Properties
| Compound Name | methyl 2-(1-fluoro-2,2-diphenylethyl)-5-methoxy-1-methyl-6-oxopyrimidine-4-carboxylate |
| PubChem CID | 170945471 |
| Molecular Formula | C22H21FN2O4 |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | methyl 2-(1-fluoro-2,2-diphenylethyl)-5-methoxy-1-methyl-6-oxopyrimidine-4-carboxylate |
| SMILES | COC(=O)c1nc(C(F)C(c2ccccc2)c2ccccc2)n(C)c(=O)c1OC |
| InChI | InChI=1S/C22H21FN2O4/c1-25-20(24-18(22(27)29-3)19(28-2)21(25)26)17(23)16(14-10-6-4-7-11-14)15-12-8-5-9-13-15/h4-13,16-17H,1-3H3 |
| InChIKey | RABAGQMRXVDKHP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-(1-fluoro-2,2-diphenylethyl)-5-methoxy-1-methyl-6-oxopyrimidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(1-fluoro-2,2-diphenylethyl)-5-methoxy-1-methyl-6-oxopyrimidine-4-carboxylate?
The IUPAC name of methyl 2-(1-fluoro-2,2-diphenylethyl)-5-methoxy-1-methyl-6-oxopyrimidine-4-carboxylate (CID 170945471) is methyl 2-(1-fluoro-2,2-diphenylethyl)-5-methoxy-1-methyl-6-oxopyrimidine-4-carboxylate.
What is the SMILES notation for methyl 2-(1-fluoro-2,2-diphenylethyl)-5-methoxy-1-methyl-6-oxopyrimidine-4-carboxylate?
The canonical SMILES for methyl 2-(1-fluoro-2,2-diphenylethyl)-5-methoxy-1-methyl-6-oxopyrimidine-4-carboxylate is COC(=O)c1nc(C(F)C(c2ccccc2)c2ccccc2)n(C)c(=O)c1OC.
What is the InChIKey of methyl 2-(1-fluoro-2,2-diphenylethyl)-5-methoxy-1-methyl-6-oxopyrimidine-4-carboxylate?
The InChIKey is RABAGQMRXVDKHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21FN2O4/c1-25-20(24-18(22(27)29-3)19(28-2)21(25)26)17(23)16(14-10-6-4-7-11-14)15-12-8-5-9-13-15/h4-13,16-17H,1-3H3.
What are the key properties of methyl 2-(1-fluoro-2,2-diphenylethyl)-5-methoxy-1-methyl-6-oxopyrimidine-4-carboxylate?
methyl 2-(1-fluoro-2,2-diphenylethyl)-5-methoxy-1-methyl-6-oxopyrimidine-4-carboxylate has a molecular weight of 396.42 g/mol, XLogP of 3.42, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(1-fluoro-2,2-diphenylethyl)-5-methoxy-1-methyl-6-oxopyrimidine-4-carboxylate is sourced from PubChem (CID 170945471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).