C41H41FN4O4 — CID 170946283
tert-butyl N-[[4-[6-[(2R)-2-fluoro-3-trityloxypropoxy]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-2-methylphenyl]methyl]carbamate (PubChem CID 170946283) has the molecular formula C41H41FN4O4 and a molecular weight of 672.80 g/mol. Its IUPAC name is tert-butyl N-[[4-[6-[(2R)-2-fluoro-3-trityloxypropoxy]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-2-methylphenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[6-[(2R)-2-fluoro-3-trityloxypropoxy]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-2-methylphenyl]methyl]carbamate |
|---|---|
| PubChem CID | 170946283 |
| Molecular Formula | C41H41FN4O4 |
| Molecular Weight | 672.80 g/mol |
| Exact Mass | 672.31 |
| IUPAC Name | tert-butyl N-[[4-[6-[(2R)-2-fluoro-3-trityloxypropoxy]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-2-methylphenyl]methyl]carbamate |
| SMILES | Cc1cc(-c2ncnn3cc(OC[C@H](F)COC(c4ccccc4)(c4ccccc4)c4ccccc4)cc23)ccc1CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C41H41FN4O4/c1-29-22-30(20-21-31(29)24-43-39(47)50-40(2,3)4)38-37-23-36(25-46(37)45-28-44-38)48-26-35(42)27-49-41(32-14-8-5-9-15-32,33-16-10-6-11-17-33)34-18-12-7-13-19-34/h5-23,25,28,35H,24,26-27H2,1-4H3,(H,43,47)/t35-/m0/s1 |
| InChIKey | HNPVEDJDUFYEER-DHUJRADRSA-N |
| XLogP | 8.46 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.80 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|