C18H17NO2 — CID 170946555
3-(anilinomethyl)-6,7-dimethylchromen-4-one (PubChem CID 170946555) has the molecular formula C18H17NO2 and a molecular weight of 279.34 g/mol. Its IUPAC name is 3-(anilinomethyl)-6,7-dimethylchromen-4-one.
| Compound Name | 3-(anilinomethyl)-6,7-dimethylchromen-4-one |
|---|---|
| PubChem CID | 170946555 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 3-(anilinomethyl)-6,7-dimethylchromen-4-one |
| SMILES | Cc1cc2occ(CNc3ccccc3)c(=O)c2cc1C |
| InChI | InChI=1S/C18H17NO2/c1-12-8-16-17(9-13(12)2)21-11-14(18(16)20)10-19-15-6-4-3-5-7-15/h3-9,11,19H,10H2,1-2H3 |
| InChIKey | XGCVXSXSQFDCQJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |