About methyl 5-acetyl-2-oxo-1-(2,2,2-trifluoroethyl)pyridine-3-carboxylate
methyl 5-acetyl-2-oxo-1-(2,2,2-trifluoroethyl)pyridine-3-carboxylate (PubChem CID 170948560) has the molecular formula C11H10F3NO4
and a molecular weight of 277.20 g/mol. Its IUPAC name is methyl 5-acetyl-2-oxo-1-(2,2,2-trifluoroethyl)pyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 5-acetyl-2-oxo-1-(2,2,2-trifluoroethyl)pyridine-3-carboxylate |
| PubChem CID | 170948560 |
| Molecular Formula | C11H10F3NO4 |
| Molecular Weight | 277.20 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | methyl 5-acetyl-2-oxo-1-(2,2,2-trifluoroethyl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1cc(C(C)=O)cn(CC(F)(F)F)c1=O |
| InChI | InChI=1S/C11H10F3NO4/c1-6(16)7-3-8(10(18)19-2)9(17)15(4-7)5-11(12,13)14/h3-4H,5H2,1-2H3 |
| InChIKey | LWLADCDJEQYBHT-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.20 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 5-acetyl-2-oxo-1-(2,2,2-trifluoroethyl)pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-acetyl-2-oxo-1-(2,2,2-trifluoroethyl)pyridine-3-carboxylate?
The IUPAC name of methyl 5-acetyl-2-oxo-1-(2,2,2-trifluoroethyl)pyridine-3-carboxylate (CID 170948560) is methyl 5-acetyl-2-oxo-1-(2,2,2-trifluoroethyl)pyridine-3-carboxylate.
What is the SMILES notation for methyl 5-acetyl-2-oxo-1-(2,2,2-trifluoroethyl)pyridine-3-carboxylate?
The canonical SMILES for methyl 5-acetyl-2-oxo-1-(2,2,2-trifluoroethyl)pyridine-3-carboxylate is COC(=O)c1cc(C(C)=O)cn(CC(F)(F)F)c1=O.
What is the InChIKey of methyl 5-acetyl-2-oxo-1-(2,2,2-trifluoroethyl)pyridine-3-carboxylate?
The InChIKey is LWLADCDJEQYBHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F3NO4/c1-6(16)7-3-8(10(18)19-2)9(17)15(4-7)5-11(12,13)14/h3-4H,5H2,1-2H3.
What are the key properties of methyl 5-acetyl-2-oxo-1-(2,2,2-trifluoroethyl)pyridine-3-carboxylate?
methyl 5-acetyl-2-oxo-1-(2,2,2-trifluoroethyl)pyridine-3-carboxylate has a molecular weight of 277.20 g/mol, XLogP of 1.40, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-acetyl-2-oxo-1-(2,2,2-trifluoroethyl)pyridine-3-carboxylate is sourced from PubChem (CID 170948560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).