C27H31F3N6O2 — CID 170948562
N-[3-[cyclobutyl-(4-methyl-1,2,4-triazol-3-yl)methyl]phenyl]-5-[(cyclopropylmethylamino)methyl]-2-oxo-1-(2,2,2-trifluoroethyl)pyridine-3-carboxamide (PubChem CID 170948562) has the molecular formula C27H31F3N6O2 and a molecular weight of 528.58 g/mol. Its IUPAC name is N-[3-[cyclobutyl-(4-methyl-1,2,4-triazol-3-yl)methyl]phenyl]-5-[(cyclopropylmethylamino)methyl]-2-oxo-1-(2,2,2-trifluoroethyl)pyridine-3-carboxamide.
| Compound Name | N-[3-[cyclobutyl-(4-methyl-1,2,4-triazol-3-yl)methyl]phenyl]-5-[(cyclopropylmethylamino)methyl]-2-oxo-1-(2,2,2-trifluoroethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 170948562 |
| Molecular Formula | C27H31F3N6O2 |
| Molecular Weight | 528.58 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | N-[3-[cyclobutyl-(4-methyl-1,2,4-triazol-3-yl)methyl]phenyl]-5-[(cyclopropylmethylamino)methyl]-2-oxo-1-(2,2,2-trifluoroethyl)pyridine-3-carboxamide |
| SMILES | Cn1cnnc1C(c1cccc(NC(=O)c2cc(CNCC3CC3)cn(CC(F)(F)F)c2=O)c1)C1CCC1 |
| InChI | InChI=1S/C27H31F3N6O2/c1-35-16-32-34-24(35)23(19-4-2-5-19)20-6-3-7-21(11-20)33-25(37)22-10-18(13-31-12-17-8-9-17)14-36(26(22)38)15-27(28,29)30/h3,6-7,10-11,14,16-17,19,23,31H,2,4-5,8-9,12-13,15H2,1H3,(H,33,37) |
| InChIKey | DYTVOAQUDQPCSH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.58 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |