C27H33F3N6O2 — CID 170948570
N-[3-[cyclobutyl-(4-methyl-1,2,4-triazol-3-yl)methyl]phenyl]-5-[(2-methylpropylamino)methyl]-2-oxo-1-(2,2,2-trifluoroethyl)pyridine-3-carboxamide (PubChem CID 170948570) has the molecular formula C27H33F3N6O2 and a molecular weight of 530.60 g/mol. Its IUPAC name is N-[3-[cyclobutyl-(4-methyl-1,2,4-triazol-3-yl)methyl]phenyl]-5-[(2-methylpropylamino)methyl]-2-oxo-1-(2,2,2-trifluoroethyl)pyridine-3-carboxamide.
| Compound Name | N-[3-[cyclobutyl-(4-methyl-1,2,4-triazol-3-yl)methyl]phenyl]-5-[(2-methylpropylamino)methyl]-2-oxo-1-(2,2,2-trifluoroethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 170948570 |
| Molecular Formula | C27H33F3N6O2 |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.26 |
| IUPAC Name | N-[3-[cyclobutyl-(4-methyl-1,2,4-triazol-3-yl)methyl]phenyl]-5-[(2-methylpropylamino)methyl]-2-oxo-1-(2,2,2-trifluoroethyl)pyridine-3-carboxamide |
| SMILES | CC(C)CNCc1cc(C(=O)Nc2cccc(C(c3nncn3C)C3CCC3)c2)c(=O)n(CC(F)(F)F)c1 |
| InChI | InChI=1S/C27H33F3N6O2/c1-17(2)12-31-13-18-10-22(26(38)36(14-18)15-27(28,29)30)25(37)33-21-9-5-8-20(11-21)23(19-6-4-7-19)24-34-32-16-35(24)3/h5,8-11,14,16-17,19,23,31H,4,6-7,12-13,15H2,1-3H3,(H,33,37) |
| InChIKey | BJXPPDLMOSVAFW-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |