C30H39F3N6O2 — CID 170948583
N-[3-[2-methyl-1-(4-methyl-1,2,4-triazol-3-yl)propan-2-yl]phenyl]-2-oxo-5-[(3-propan-2-ylpiperidin-1-yl)methyl]-1-(2,2,2-trifluoroethyl)pyridine-3-carboxamide (PubChem CID 170948583) has the molecular formula C30H39F3N6O2 and a molecular weight of 572.68 g/mol. Its IUPAC name is N-[3-[2-methyl-1-(4-methyl-1,2,4-triazol-3-yl)propan-2-yl]phenyl]-2-oxo-5-[(3-propan-2-ylpiperidin-1-yl)methyl]-1-(2,2,2-trifluoroethyl)pyridine-3-carboxamide.
| Compound Name | N-[3-[2-methyl-1-(4-methyl-1,2,4-triazol-3-yl)propan-2-yl]phenyl]-2-oxo-5-[(3-propan-2-ylpiperidin-1-yl)methyl]-1-(2,2,2-trifluoroethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 170948583 |
| Molecular Formula | C30H39F3N6O2 |
| Molecular Weight | 572.68 g/mol |
| Exact Mass | 572.31 |
| IUPAC Name | N-[3-[2-methyl-1-(4-methyl-1,2,4-triazol-3-yl)propan-2-yl]phenyl]-2-oxo-5-[(3-propan-2-ylpiperidin-1-yl)methyl]-1-(2,2,2-trifluoroethyl)pyridine-3-carboxamide |
| SMILES | CC(C)C1CCCN(Cc2cc(C(=O)Nc3cccc(C(C)(C)Cc4nncn4C)c3)c(=O)n(CC(F)(F)F)c2)C1 |
| InChI | InChI=1S/C30H39F3N6O2/c1-20(2)22-8-7-11-38(17-22)15-21-12-25(28(41)39(16-21)18-30(31,32)33)27(40)35-24-10-6-9-23(13-24)29(3,4)14-26-36-34-19-37(26)5/h6,9-10,12-13,16,19-20,22H,7-8,11,14-15,17-18H2,1-5H3,(H,35,40) |
| InChIKey | UKEGBQRQQXKLLA-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 85.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.68 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |