C28H35F3N6O2 — CID 170948592
N-[3-[2-methyl-1-(4-methyl-1,2,4-triazol-3-yl)propan-2-yl]phenyl]-5-[[(3S)-3-methylpiperidin-1-yl]methyl]-2-oxo-1-(2,2,2-trifluoroethyl)pyridine-3-carboxamide (PubChem CID 170948592) has the molecular formula C28H35F3N6O2 and a molecular weight of 544.62 g/mol. Its IUPAC name is N-[3-[2-methyl-1-(4-methyl-1,2,4-triazol-3-yl)propan-2-yl]phenyl]-5-[[(3S)-3-methylpiperidin-1-yl]methyl]-2-oxo-1-(2,2,2-trifluoroethyl)pyridine-3-carboxamide.
| Compound Name | N-[3-[2-methyl-1-(4-methyl-1,2,4-triazol-3-yl)propan-2-yl]phenyl]-5-[[(3S)-3-methylpiperidin-1-yl]methyl]-2-oxo-1-(2,2,2-trifluoroethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 170948592 |
| Molecular Formula | C28H35F3N6O2 |
| Molecular Weight | 544.62 g/mol |
| Exact Mass | 544.28 |
| IUPAC Name | N-[3-[2-methyl-1-(4-methyl-1,2,4-triazol-3-yl)propan-2-yl]phenyl]-5-[[(3S)-3-methylpiperidin-1-yl]methyl]-2-oxo-1-(2,2,2-trifluoroethyl)pyridine-3-carboxamide |
| SMILES | C[C@H]1CCCN(Cc2cc(C(=O)Nc3cccc(C(C)(C)Cc4nncn4C)c3)c(=O)n(CC(F)(F)F)c2)C1 |
| InChI | InChI=1S/C28H35F3N6O2/c1-19-7-6-10-36(14-19)15-20-11-23(26(39)37(16-20)17-28(29,30)31)25(38)33-22-9-5-8-21(12-22)27(2,3)13-24-34-32-18-35(24)4/h5,8-9,11-12,16,18-19H,6-7,10,13-15,17H2,1-4H3,(H,33,38)/t19-/m0/s1 |
| InChIKey | PYLBLFLBPVAWNL-IBGZPJMESA-N |
| XLogP | 4.54 |
| TPSA | 85.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.62 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |