C21H16Cl2N4O2 — CID 170949148
4-[5-(3,4-dichlorophenyl)-3-quinoxalin-6-yl-3,4-dihydropyrazol-2-yl]-4-oxobutanal (PubChem CID 170949148) has the molecular formula C21H16Cl2N4O2 and a molecular weight of 427.29 g/mol. Its IUPAC name is 4-[5-(3,4-dichlorophenyl)-3-quinoxalin-6-yl-3,4-dihydropyrazol-2-yl]-4-oxobutanal.
| Compound Name | 4-[5-(3,4-dichlorophenyl)-3-quinoxalin-6-yl-3,4-dihydropyrazol-2-yl]-4-oxobutanal |
|---|---|
| PubChem CID | 170949148 |
| Molecular Formula | C21H16Cl2N4O2 |
| Molecular Weight | 427.29 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | 4-[5-(3,4-dichlorophenyl)-3-quinoxalin-6-yl-3,4-dihydropyrazol-2-yl]-4-oxobutanal |
| SMILES | O=CCCC(=O)N1N=C(c2ccc(Cl)c(Cl)c2)CC1c1ccc2nccnc2c1 |
| InChI | InChI=1S/C21H16Cl2N4O2/c22-15-5-3-13(10-16(15)23)18-12-20(27(26-18)21(29)2-1-9-28)14-4-6-17-19(11-14)25-8-7-24-17/h3-11,20H,1-2,12H2 |
| InChIKey | NQBFWAKBXURNLV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 75.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.29 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|