C32H40N2O4 — CID 17094971
1-N,4-N-bis(3-hexoxyphenyl)benzene-1,4-dicarboxamide (PubChem CID 17094971) has the molecular formula C32H40N2O4 and a molecular weight of 516.68 g/mol. Its IUPAC name is 1-N,4-N-bis(3-hexoxyphenyl)benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis(3-hexoxyphenyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 17094971 |
| Molecular Formula | C32H40N2O4 |
| Molecular Weight | 516.68 g/mol |
| Exact Mass | 516.30 |
| IUPAC Name | 1-N,4-N-bis(3-hexoxyphenyl)benzene-1,4-dicarboxamide |
| SMILES | CCCCCCOc1cccc(NC(=O)c2ccc(C(=O)Nc3cccc(OCCCCCC)c3)cc2)c1 |
| InChI | InChI=1S/C32H40N2O4/c1-3-5-7-9-21-37-29-15-11-13-27(23-29)33-31(35)25-17-19-26(20-18-25)32(36)34-28-14-12-16-30(24-28)38-22-10-8-6-4-2/h11-20,23-24H,3-10,21-22H2,1-2H3,(H,33,35)(H,34,36) |
| InChIKey | NEGFGUQXKPJALR-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.68 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|