About 7-[[2-(fluoromethyl)-1,3-thiazol-5-yl]sulfanylamino]-1H-indole-3-carbonitrile
7-[[2-(fluoromethyl)-1,3-thiazol-5-yl]sulfanylamino]-1H-indole-3-carbonitrile (PubChem CID 170949823) has the molecular formula C13H9FN4S2
and a molecular weight of 304.38 g/mol. Its IUPAC name is 7-[[2-(fluoromethyl)-1,3-thiazol-5-yl]sulfanylamino]-1H-indole-3-carbonitrile.
Molecular Properties
| Compound Name | 7-[[2-(fluoromethyl)-1,3-thiazol-5-yl]sulfanylamino]-1H-indole-3-carbonitrile |
| PubChem CID | 170949823 |
| Molecular Formula | C13H9FN4S2 |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 7-[[2-(fluoromethyl)-1,3-thiazol-5-yl]sulfanylamino]-1H-indole-3-carbonitrile |
| SMILES | N#Cc1c[nH]c2c(NSc3cnc(CF)s3)cccc12 |
| InChI | InChI=1S/C13H9FN4S2/c14-4-11-16-7-12(19-11)20-18-10-3-1-2-9-8(5-15)6-17-13(9)10/h1-3,6-7,17-18H,4H2 |
| InChIKey | TZOIPFJHWMZAMP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 64.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-[[2-(fluoromethyl)-1,3-thiazol-5-yl]sulfanylamino]-1H-indole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[[2-(fluoromethyl)-1,3-thiazol-5-yl]sulfanylamino]-1H-indole-3-carbonitrile?
The IUPAC name of 7-[[2-(fluoromethyl)-1,3-thiazol-5-yl]sulfanylamino]-1H-indole-3-carbonitrile (CID 170949823) is 7-[[2-(fluoromethyl)-1,3-thiazol-5-yl]sulfanylamino]-1H-indole-3-carbonitrile.
What is the SMILES notation for 7-[[2-(fluoromethyl)-1,3-thiazol-5-yl]sulfanylamino]-1H-indole-3-carbonitrile?
The canonical SMILES for 7-[[2-(fluoromethyl)-1,3-thiazol-5-yl]sulfanylamino]-1H-indole-3-carbonitrile is N#Cc1c[nH]c2c(NSc3cnc(CF)s3)cccc12.
What is the InChIKey of 7-[[2-(fluoromethyl)-1,3-thiazol-5-yl]sulfanylamino]-1H-indole-3-carbonitrile?
The InChIKey is TZOIPFJHWMZAMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9FN4S2/c14-4-11-16-7-12(19-11)20-18-10-3-1-2-9-8(5-15)6-17-13(9)10/h1-3,6-7,17-18H,4H2.
What are the key properties of 7-[[2-(fluoromethyl)-1,3-thiazol-5-yl]sulfanylamino]-1H-indole-3-carbonitrile?
7-[[2-(fluoromethyl)-1,3-thiazol-5-yl]sulfanylamino]-1H-indole-3-carbonitrile has a molecular weight of 304.38 g/mol, XLogP of 4.08, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[[2-(fluoromethyl)-1,3-thiazol-5-yl]sulfanylamino]-1H-indole-3-carbonitrile is sourced from PubChem (CID 170949823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).