About methyl 2-[[(3S)-1-(3,3-difluoropropyl)pyrrolidin-3-yl]methyl]-1,3-thiazole-5-carboxylate
methyl 2-[[(3S)-1-(3,3-difluoropropyl)pyrrolidin-3-yl]methyl]-1,3-thiazole-5-carboxylate (PubChem CID 170950818) has the molecular formula C13H18F2N2O2S
and a molecular weight of 304.36 g/mol. Its IUPAC name is methyl 2-[[(3S)-1-(3,3-difluoropropyl)pyrrolidin-3-yl]methyl]-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | methyl 2-[[(3S)-1-(3,3-difluoropropyl)pyrrolidin-3-yl]methyl]-1,3-thiazole-5-carboxylate |
| PubChem CID | 170950818 |
| Molecular Formula | C13H18F2N2O2S |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | methyl 2-[[(3S)-1-(3,3-difluoropropyl)pyrrolidin-3-yl]methyl]-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1cnc(C[C@@H]2CCN(CCC(F)F)C2)s1 |
| InChI | InChI=1S/C13H18F2N2O2S/c1-19-13(18)10-7-16-12(20-10)6-9-2-4-17(8-9)5-3-11(14)15/h7,9,11H,2-6,8H2,1H3/t9-/m0/s1 |
| InChIKey | ZRKRUGZPZLRTQM-VIFPVBQESA-N |
| XLogP | 2.45 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-[[(3S)-1-(3,3-difluoropropyl)pyrrolidin-3-yl]methyl]-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[(3S)-1-(3,3-difluoropropyl)pyrrolidin-3-yl]methyl]-1,3-thiazole-5-carboxylate?
The IUPAC name of methyl 2-[[(3S)-1-(3,3-difluoropropyl)pyrrolidin-3-yl]methyl]-1,3-thiazole-5-carboxylate (CID 170950818) is methyl 2-[[(3S)-1-(3,3-difluoropropyl)pyrrolidin-3-yl]methyl]-1,3-thiazole-5-carboxylate.
What is the SMILES notation for methyl 2-[[(3S)-1-(3,3-difluoropropyl)pyrrolidin-3-yl]methyl]-1,3-thiazole-5-carboxylate?
The canonical SMILES for methyl 2-[[(3S)-1-(3,3-difluoropropyl)pyrrolidin-3-yl]methyl]-1,3-thiazole-5-carboxylate is COC(=O)c1cnc(C[C@@H]2CCN(CCC(F)F)C2)s1.
What is the InChIKey of methyl 2-[[(3S)-1-(3,3-difluoropropyl)pyrrolidin-3-yl]methyl]-1,3-thiazole-5-carboxylate?
The InChIKey is ZRKRUGZPZLRTQM-VIFPVBQESA-N. The full InChI is InChI=1S/C13H18F2N2O2S/c1-19-13(18)10-7-16-12(20-10)6-9-2-4-17(8-9)5-3-11(14)15/h7,9,11H,2-6,8H2,1H3/t9-/m0/s1.
What are the key properties of methyl 2-[[(3S)-1-(3,3-difluoropropyl)pyrrolidin-3-yl]methyl]-1,3-thiazole-5-carboxylate?
methyl 2-[[(3S)-1-(3,3-difluoropropyl)pyrrolidin-3-yl]methyl]-1,3-thiazole-5-carboxylate has a molecular weight of 304.36 g/mol, XLogP of 2.45, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[(3S)-1-(3,3-difluoropropyl)pyrrolidin-3-yl]methyl]-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 170950818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).