C11H15FN2OS — CID 170950858
2-[[1-(3-fluoropropyl)azetidin-3-yl]methyl]-1,3-thiazole-5-carbaldehyde (PubChem CID 170950858) has the molecular formula C11H15FN2OS and a molecular weight of 242.32 g/mol. Its IUPAC name is 2-[[1-(3-fluoropropyl)azetidin-3-yl]methyl]-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-[[1-(3-fluoropropyl)azetidin-3-yl]methyl]-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 170950858 |
| Molecular Formula | C11H15FN2OS |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 2-[[1-(3-fluoropropyl)azetidin-3-yl]methyl]-1,3-thiazole-5-carbaldehyde |
| SMILES | O=Cc1cnc(CC2CN(CCCF)C2)s1 |
| InChI | InChI=1S/C11H15FN2OS/c12-2-1-3-14-6-9(7-14)4-11-13-5-10(8-15)16-11/h5,8-9H,1-4,6-7H2 |
| InChIKey | LVNUTZLVIYEXCY-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|