C23H19N5O2 — CID 170951384
2-(15-methoxy-2,4,10,11-tetrazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8(12),9,14,16-heptaen-5-yl)-4-phenyl-4,5-dihydro-1,3-oxazole (PubChem CID 170951384) has the molecular formula C23H19N5O2 and a molecular weight of 397.44 g/mol. Its IUPAC name is 2-(15-methoxy-2,4,10,11-tetrazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8(12),9,14,16-heptaen-5-yl)-4-phenyl-4,5-dihydro-1,3-oxazole.
| Compound Name | 2-(15-methoxy-2,4,10,11-tetrazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8(12),9,14,16-heptaen-5-yl)-4-phenyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 170951384 |
| Molecular Formula | C23H19N5O2 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 2-(15-methoxy-2,4,10,11-tetrazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8(12),9,14,16-heptaen-5-yl)-4-phenyl-4,5-dihydro-1,3-oxazole |
| SMILES | COc1ccc2c(c1)-c1[nH]ncc1Cc1c(C3=NC(c4ccccc4)CO3)ncn1-2 |
| InChI | InChI=1S/C23H19N5O2/c1-29-16-7-8-19-17(10-16)21-15(11-25-27-21)9-20-22(24-13-28(19)20)23-26-18(12-30-23)14-5-3-2-4-6-14/h2-8,10-11,13,18H,9,12H2,1H3,(H,25,27) |
| InChIKey | FQUFMPSCNMYUOM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 77.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |