C21H32N6OS — CID 170952223
2'-[[1-(2-aminopropan-2-ylsulfanyl)piperidin-4-yl]amino]-7'-cyclopentylspiro[cyclopropane-1,5'-pyrrolo[2,3-d]pyrimidine]-6'-one (PubChem CID 170952223) has the molecular formula C21H32N6OS and a molecular weight of 416.60 g/mol. Its IUPAC name is 2'-[[1-(2-aminopropan-2-ylsulfanyl)piperidin-4-yl]amino]-7'-cyclopentylspiro[cyclopropane-1,5'-pyrrolo[2,3-d]pyrimidine]-6'-one.
| Compound Name | 2'-[[1-(2-aminopropan-2-ylsulfanyl)piperidin-4-yl]amino]-7'-cyclopentylspiro[cyclopropane-1,5'-pyrrolo[2,3-d]pyrimidine]-6'-one |
|---|---|
| PubChem CID | 170952223 |
| Molecular Formula | C21H32N6OS |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | 2'-[[1-(2-aminopropan-2-ylsulfanyl)piperidin-4-yl]amino]-7'-cyclopentylspiro[cyclopropane-1,5'-pyrrolo[2,3-d]pyrimidine]-6'-one |
| SMILES | CC(C)(N)SN1CCC(Nc2ncc3c(n2)N(C2CCCC2)C(=O)C32CC2)CC1 |
| InChI | InChI=1S/C21H32N6OS/c1-20(2,22)29-26-11-7-14(8-12-26)24-19-23-13-16-17(25-19)27(15-5-3-4-6-15)18(28)21(16)9-10-21/h13-15H,3-12,22H2,1-2H3,(H,23,24,25) |
| InChIKey | XPMVDYQWBWKETO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|