About 1-[[3,3-difluoro-1-(3-propan-2-ylcyclobutyl)piperidin-4-yl]methyl]-4-propan-2-ylpiperazine
1-[[3,3-difluoro-1-(3-propan-2-ylcyclobutyl)piperidin-4-yl]methyl]-4-propan-2-ylpiperazine (PubChem CID 170952550) has the molecular formula C20H37F2N3
and a molecular weight of 357.53 g/mol. Its IUPAC name is 1-[[3,3-difluoro-1-(3-propan-2-ylcyclobutyl)piperidin-4-yl]methyl]-4-propan-2-ylpiperazine.
Molecular Properties
| Compound Name | 1-[[3,3-difluoro-1-(3-propan-2-ylcyclobutyl)piperidin-4-yl]methyl]-4-propan-2-ylpiperazine |
| PubChem CID | 170952550 |
| Molecular Formula | C20H37F2N3 |
| Molecular Weight | 357.53 g/mol |
| Exact Mass | 357.30 |
| IUPAC Name | 1-[[3,3-difluoro-1-(3-propan-2-ylcyclobutyl)piperidin-4-yl]methyl]-4-propan-2-ylpiperazine |
| SMILES | CC(C)C1CC(N2CCC(CN3CCN(C(C)C)CC3)C(F)(F)C2)C1 |
| InChI | InChI=1S/C20H37F2N3/c1-15(2)17-11-19(12-17)25-6-5-18(20(21,22)14-25)13-23-7-9-24(10-8-23)16(3)4/h15-19H,5-14H2,1-4H3 |
| InChIKey | DOCMJSNHMRSZBP-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.53 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[[3,3-difluoro-1-(3-propan-2-ylcyclobutyl)piperidin-4-yl]methyl]-4-propan-2-ylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[3,3-difluoro-1-(3-propan-2-ylcyclobutyl)piperidin-4-yl]methyl]-4-propan-2-ylpiperazine?
The IUPAC name of 1-[[3,3-difluoro-1-(3-propan-2-ylcyclobutyl)piperidin-4-yl]methyl]-4-propan-2-ylpiperazine (CID 170952550) is 1-[[3,3-difluoro-1-(3-propan-2-ylcyclobutyl)piperidin-4-yl]methyl]-4-propan-2-ylpiperazine.
What is the SMILES notation for 1-[[3,3-difluoro-1-(3-propan-2-ylcyclobutyl)piperidin-4-yl]methyl]-4-propan-2-ylpiperazine?
The canonical SMILES for 1-[[3,3-difluoro-1-(3-propan-2-ylcyclobutyl)piperidin-4-yl]methyl]-4-propan-2-ylpiperazine is CC(C)C1CC(N2CCC(CN3CCN(C(C)C)CC3)C(F)(F)C2)C1.
What is the InChIKey of 1-[[3,3-difluoro-1-(3-propan-2-ylcyclobutyl)piperidin-4-yl]methyl]-4-propan-2-ylpiperazine?
The InChIKey is DOCMJSNHMRSZBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H37F2N3/c1-15(2)17-11-19(12-17)25-6-5-18(20(21,22)14-25)13-23-7-9-24(10-8-23)16(3)4/h15-19H,5-14H2,1-4H3.
What are the key properties of 1-[[3,3-difluoro-1-(3-propan-2-ylcyclobutyl)piperidin-4-yl]methyl]-4-propan-2-ylpiperazine?
1-[[3,3-difluoro-1-(3-propan-2-ylcyclobutyl)piperidin-4-yl]methyl]-4-propan-2-ylpiperazine has a molecular weight of 357.53 g/mol, XLogP of 3.40, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[3,3-difluoro-1-(3-propan-2-ylcyclobutyl)piperidin-4-yl]methyl]-4-propan-2-ylpiperazine is sourced from PubChem (CID 170952550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).