C20H42N2O — CID 170953550
butan-2-ylcyclohexane;2-(methoxymethyl)-1-methyl-4-propan-2-ylpiperazine (PubChem CID 170953550) has the molecular formula C20H42N2O and a molecular weight of 326.57 g/mol. Its IUPAC name is butan-2-ylcyclohexane;2-(methoxymethyl)-1-methyl-4-propan-2-ylpiperazine.
| Compound Name | butan-2-ylcyclohexane;2-(methoxymethyl)-1-methyl-4-propan-2-ylpiperazine |
|---|---|
| PubChem CID | 170953550 |
| Molecular Formula | C20H42N2O |
| Molecular Weight | 326.57 g/mol |
| Exact Mass | 326.33 |
| IUPAC Name | butan-2-ylcyclohexane;2-(methoxymethyl)-1-methyl-4-propan-2-ylpiperazine |
| SMILES | CCC(C)C1CCCCC1.COCC1CN(C(C)C)CCN1C |
| InChI | InChI=1S/C10H22N2O.C10H20/c1-9(2)12-6-5-11(3)10(7-12)8-13-4;1-3-9(2)10-7-5-4-6-8-10/h9-10H,5-8H2,1-4H3;9-10H,3-8H2,1-2H3 |
| InChIKey | GIAJMCVPVPCGGJ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.57 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |