C28H41FN4O4 — CID 170953663
tert-butyl N-[4-[[(2S)-4-[4-(2,6-dioxopiperidin-3-yl)-2-fluorophenyl]-2-methylpiperazin-1-yl]methyl]cyclohexyl]carbamate (PubChem CID 170953663) has the molecular formula C28H41FN4O4 and a molecular weight of 516.66 g/mol. Its IUPAC name is tert-butyl N-[4-[[(2S)-4-[4-(2,6-dioxopiperidin-3-yl)-2-fluorophenyl]-2-methylpiperazin-1-yl]methyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[[(2S)-4-[4-(2,6-dioxopiperidin-3-yl)-2-fluorophenyl]-2-methylpiperazin-1-yl]methyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 170953663 |
| Molecular Formula | C28H41FN4O4 |
| Molecular Weight | 516.66 g/mol |
| Exact Mass | 516.31 |
| IUPAC Name | tert-butyl N-[4-[[(2S)-4-[4-(2,6-dioxopiperidin-3-yl)-2-fluorophenyl]-2-methylpiperazin-1-yl]methyl]cyclohexyl]carbamate |
| SMILES | C[C@H]1CN(c2ccc(C3CCC(=O)NC3=O)cc2F)CCN1CC1CCC(NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C28H41FN4O4/c1-18-16-33(24-11-7-20(15-23(24)29)22-10-12-25(34)31-26(22)35)14-13-32(18)17-19-5-8-21(9-6-19)30-27(36)37-28(2,3)4/h7,11,15,18-19,21-22H,5-6,8-10,12-14,16-17H2,1-4H3,(H,30,36)(H,31,34,35)/t18-,19?,21?,22?/m0/s1 |
| InChIKey | ZRJPPMFZKBEABP-RZMUKEPRSA-N |
| XLogP | 3.94 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.66 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|