C23H45N3 — CID 170953915
1-(4-butan-2-ylcyclohexyl)-4-[(1-propan-2-ylpiperidin-4-yl)methyl]piperazine (PubChem CID 170953915) has the molecular formula C23H45N3 and a molecular weight of 363.63 g/mol. Its IUPAC name is 1-(4-butan-2-ylcyclohexyl)-4-[(1-propan-2-ylpiperidin-4-yl)methyl]piperazine.
| Compound Name | 1-(4-butan-2-ylcyclohexyl)-4-[(1-propan-2-ylpiperidin-4-yl)methyl]piperazine |
|---|---|
| PubChem CID | 170953915 |
| Molecular Formula | C23H45N3 |
| Molecular Weight | 363.63 g/mol |
| Exact Mass | 363.36 |
| IUPAC Name | 1-(4-butan-2-ylcyclohexyl)-4-[(1-propan-2-ylpiperidin-4-yl)methyl]piperazine |
| SMILES | CCC(C)C1CCC(N2CCN(CC3CCN(C(C)C)CC3)CC2)CC1 |
| InChI | InChI=1S/C23H45N3/c1-5-20(4)22-6-8-23(9-7-22)26-16-14-24(15-17-26)18-21-10-12-25(13-11-21)19(2)3/h19-23H,5-18H2,1-4H3 |
| InChIKey | FLIXRIHLMMVDQJ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.63 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |