C15H40N4OS2 — CID 170954466
N'-[[dimethyl(methylsulfanyloxy)-λ4-sulfanyl]methyl]-N-methylpropane-1,3-diamine;N-methyl-N'-propylpropane-1,3-diamine (PubChem CID 170954466) has the molecular formula C15H40N4OS2 and a molecular weight of 356.65 g/mol. Its IUPAC name is N'-[[dimethyl(methylsulfanyloxy)-λ4-sulfanyl]methyl]-N-methylpropane-1,3-diamine;N-methyl-N'-propylpropane-1,3-diamine.
| Compound Name | N'-[[dimethyl(methylsulfanyloxy)-λ4-sulfanyl]methyl]-N-methylpropane-1,3-diamine;N-methyl-N'-propylpropane-1,3-diamine |
|---|---|
| PubChem CID | 170954466 |
| Molecular Formula | C15H40N4OS2 |
| Molecular Weight | 356.65 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | N'-[[dimethyl(methylsulfanyloxy)-λ4-sulfanyl]methyl]-N-methylpropane-1,3-diamine;N-methyl-N'-propylpropane-1,3-diamine |
| SMILES | CCCNCCCNC.CNCCCNCS(C)(C)OSC |
| InChI | InChI=1S/C8H22N2OS2.C7H18N2/c1-9-6-5-7-10-8-13(3,4)11-12-2;1-3-5-9-7-4-6-8-2/h9-10H,5-8H2,1-4H3;8-9H,3-7H2,1-2H3 |
| InChIKey | QRADTFSQEWOABE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 57.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.65 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|