C28H43I — CID 170954582
(9S,10S,13R,14R,17R)-17-[(E,4R)-4,5-dimethylhex-2-enyl]-9-iodo-10,13,14-trimethyl-2,3,4,11,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 170954582) has the molecular formula C28H43I and a molecular weight of 506.56 g/mol. Its IUPAC name is (9S,10S,13R,14R,17R)-17-[(E,4R)-4,5-dimethylhex-2-enyl]-9-iodo-10,13,14-trimethyl-2,3,4,11,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (9S,10S,13R,14R,17R)-17-[(E,4R)-4,5-dimethylhex-2-enyl]-9-iodo-10,13,14-trimethyl-2,3,4,11,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 170954582 |
| Molecular Formula | C28H43I |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | (9S,10S,13R,14R,17R)-17-[(E,4R)-4,5-dimethylhex-2-enyl]-9-iodo-10,13,14-trimethyl-2,3,4,11,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CC(C)[C@@H](C)/C=C/C[C@H]1CC[C@@]2(C)C3=CC=C4CCCC[C@]4(C)[C@@]3(I)CC[C@]12C |
| InChI | InChI=1S/C28H43I/c1-20(2)21(3)10-9-12-23-15-17-27(6)24-14-13-22-11-7-8-16-26(22,5)28(24,29)19-18-25(23,27)4/h9-10,13-14,20-21,23H,7-8,11-12,15-19H2,1-6H3/b10-9+/t21-,23-,25+,26-,27-,28+/m0/s1 |
| InChIKey | VNYILCJIXGFOHR-OPIIKLPHSA-N |
| XLogP | 9.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|