C16H19NO2 — CID 170955115
N-[1-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]-2-hydroxyethyl]formamide (PubChem CID 170955115) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is N-[1-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]-2-hydroxyethyl]formamide.
| Compound Name | N-[1-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]-2-hydroxyethyl]formamide |
|---|---|
| PubChem CID | 170955115 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | N-[1-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]-2-hydroxyethyl]formamide |
| SMILES | C=C/C=C(\C=C/C)c1ccc(C(CO)NC=O)cc1 |
| InChI | InChI=1S/C16H19NO2/c1-3-5-13(6-4-2)14-7-9-15(10-8-14)16(11-18)17-12-19/h3-10,12,16,18H,1,11H2,2H3,(H,17,19)/b6-4-,13-5+ |
| InChIKey | MOLNDEPRLVYJDV-GLRUQPRCSA-N |
| XLogP | 2.61 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|