About 3-ethyl-4,5-difluoro-2-methanimidoylaniline
3-ethyl-4,5-difluoro-2-methanimidoylaniline (PubChem CID 170956228) has the molecular formula C9H10F2N2
and a molecular weight of 184.19 g/mol. Its IUPAC name is 3-ethyl-4,5-difluoro-2-methanimidoylaniline.
Molecular Properties
| Compound Name | 3-ethyl-4,5-difluoro-2-methanimidoylaniline |
| PubChem CID | 170956228 |
| Molecular Formula | C9H10F2N2 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 3-ethyl-4,5-difluoro-2-methanimidoylaniline |
| SMILES | [H]/N=C/c1c(N)cc(F)c(F)c1CC |
| InChI | InChI=1S/C9H10F2N2/c1-2-5-6(4-12)8(13)3-7(10)9(5)11/h3-4,12H,2,13H2,1H3/b12-4+ |
| InChIKey | LGEPARDRGOWXHO-UUILKARUSA-N |
| XLogP | 2.11 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-4,5-difluoro-2-methanimidoylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-4,5-difluoro-2-methanimidoylaniline?
The IUPAC name of 3-ethyl-4,5-difluoro-2-methanimidoylaniline (CID 170956228) is 3-ethyl-4,5-difluoro-2-methanimidoylaniline.
What is the SMILES notation for 3-ethyl-4,5-difluoro-2-methanimidoylaniline?
The canonical SMILES for 3-ethyl-4,5-difluoro-2-methanimidoylaniline is [H]/N=C/c1c(N)cc(F)c(F)c1CC.
What is the InChIKey of 3-ethyl-4,5-difluoro-2-methanimidoylaniline?
The InChIKey is LGEPARDRGOWXHO-UUILKARUSA-N. The full InChI is InChI=1S/C9H10F2N2/c1-2-5-6(4-12)8(13)3-7(10)9(5)11/h3-4,12H,2,13H2,1H3/b12-4+.
What are the key properties of 3-ethyl-4,5-difluoro-2-methanimidoylaniline?
3-ethyl-4,5-difluoro-2-methanimidoylaniline has a molecular weight of 184.19 g/mol, XLogP of 2.11, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-4,5-difluoro-2-methanimidoylaniline is sourced from PubChem (CID 170956228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).